C36H44Cl2FN5O3 — CID 153292565
tert-butyl (2R,5S)-4-[C-[2,5-dichloro-6-(2-fluorophenyl)-3-pyridinyl]-N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]carbonimidoyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 153292565) has the molecular formula C36H44Cl2FN5O3 and a molecular weight of 684.68 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-[C-[2,5-dichloro-6-(2-fluorophenyl)-3-pyridinyl]-N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]carbonimidoyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-[C-[2,5-dichloro-6-(2-fluorophenyl)-3-pyridinyl]-N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]carbonimidoyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 153292565 |
| Molecular Formula | C36H44Cl2FN5O3 |
| Molecular Weight | 684.68 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | tert-butyl (2R,5S)-4-[C-[2,5-dichloro-6-(2-fluorophenyl)-3-pyridinyl]-N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]carbonimidoyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)N=C(c1cc(Cl)c(-c2ccccc2F)nc1Cl)N1C[C@@H](C)N(C(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C36H44Cl2FN5O3/c1-20(2)24-14-12-15-25(21(3)4)30(24)41-34(45)42-33(43-18-23(6)44(19-22(43)5)35(46)47-36(7,8)9)27-17-28(37)31(40-32(27)38)26-13-10-11-16-29(26)39/h10-17,20-23H,18-19H2,1-9H3,(H,41,45)/t22-,23+/m0/s1 |
| InChIKey | QNYPHGUZRNAIMC-XZOQPEGZSA-N |
| XLogP | 9.75 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.68 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|