C33H40ClFN5O3P — CID 153276857
tert-butyl (2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-methyl-2-oxo-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-4-yl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 153276857) has the molecular formula C33H40ClFN5O3P and a molecular weight of 640.14 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-methyl-2-oxo-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-4-yl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-methyl-2-oxo-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 153276857 |
| Molecular Formula | C33H40ClFN5O3P |
| Molecular Weight | 640.14 g/mol |
| Exact Mass | 639.25 |
| IUPAC Name | tert-butyl (2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-methyl-2-oxo-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | CC(C)c1ccccc1N1c2nc(-c3ccccc3F)c(Cl)cc2C(N2C[C@@H](C)N(C(=O)OC(C)(C)C)C[C@@H]2C)=NP1(C)=O |
| InChI | InChI=1S/C33H40ClFN5O3P/c1-20(2)23-13-10-12-16-28(23)40-30-25(17-26(34)29(36-30)24-14-9-11-15-27(24)35)31(37-44(40,8)42)38-18-22(4)39(19-21(38)3)32(41)43-33(5,6)7/h9-17,20-22H,18-19H2,1-8H3/t21-,22+,44?/m0/s1 |
| InChIKey | MJYHGUVXTWRTHU-ZZYXISLASA-N |
| XLogP | 8.72 |
| TPSA | 78.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.14 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|