C27H35Cl2N5O4S — CID 153278755
tert-butyl (2R,5S)-4-[1-(2-tert-butylphenyl)-6,7-dichloro-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 153278755) has the molecular formula C27H35Cl2N5O4S and a molecular weight of 596.58 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-[1-(2-tert-butylphenyl)-6,7-dichloro-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-[1-(2-tert-butylphenyl)-6,7-dichloro-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 153278755 |
| Molecular Formula | C27H35Cl2N5O4S |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | tert-butyl (2R,5S)-4-[1-(2-tert-butylphenyl)-6,7-dichloro-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C2=NS(=O)(=O)N(c3ccccc3C(C)(C)C)c3nc(Cl)c(Cl)cc32)[C@@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H35Cl2N5O4S/c1-16-15-33(25(35)38-27(6,7)8)17(2)14-32(16)24-18-13-20(28)22(29)30-23(18)34(39(36,37)31-24)21-12-10-9-11-19(21)26(3,4)5/h9-13,16-17H,14-15H2,1-8H3/t16-,17+/m0/s1 |
| InChIKey | UBROEWMZCXNCEL-DLBZAZTESA-N |
| XLogP | 6.16 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|