C23H27Cl2FN4O2 — CID 146253053
tert-butyl (2R,5S)-4-[2,5-dichloro-6-(2-fluorophenyl)pyridine-3-carboximidoyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 146253053) has the molecular formula C23H27Cl2FN4O2 and a molecular weight of 481.40 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-[2,5-dichloro-6-(2-fluorophenyl)pyridine-3-carboximidoyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-[2,5-dichloro-6-(2-fluorophenyl)pyridine-3-carboximidoyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146253053 |
| Molecular Formula | C23H27Cl2FN4O2 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | tert-butyl (2R,5S)-4-[2,5-dichloro-6-(2-fluorophenyl)pyridine-3-carboximidoyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | [H]/N=C(/c1cc(Cl)c(-c2ccccc2F)nc1Cl)N1C[C@@H](C)N(C(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C23H27Cl2FN4O2/c1-13-12-30(22(31)32-23(3,4)5)14(2)11-29(13)21(27)16-10-17(24)19(28-20(16)25)15-8-6-7-9-18(15)26/h6-10,13-14,27H,11-12H2,1-5H3/b27-21-/t13-,14+/m0/s1 |
| InChIKey | RZASAHPBMFLZAX-MMLUWQEPSA-N |
| XLogP | 5.85 |
| TPSA | 69.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|