C17H25N3O2 — CID 58852064
tert-butyl (2S)-4-(benzenecarboximidoyl)-2-methylpiperazine-1-carboxylate (PubChem CID 58852064) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is tert-butyl (2S)-4-(benzenecarboximidoyl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(benzenecarboximidoyl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58852064 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | tert-butyl (2S)-4-(benzenecarboximidoyl)-2-methylpiperazine-1-carboxylate |
| SMILES | [H]/N=C(\c1ccccc1)N1CCN(C(=O)OC(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C17H25N3O2/c1-13-12-19(15(18)14-8-6-5-7-9-14)10-11-20(13)16(21)22-17(2,3)4/h5-9,13,18H,10-12H2,1-4H3/b18-15+/t13-/m0/s1 |
| InChIKey | YCVPFZJDXANKDP-BWVAZPDUSA-N |
| XLogP | 2.95 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|