C34H40ClFN6O5S — CID 146253251
tert-butyl (2R,5S)-4-[7-(2-amino-6-fluorophenyl)-6-chloro-1-(4-formyl-2-methyl-6-propan-2-ylphenyl)-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 146253251) has the molecular formula C34H40ClFN6O5S and a molecular weight of 699.25 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-[7-(2-amino-6-fluorophenyl)-6-chloro-1-(4-formyl-2-methyl-6-propan-2-ylphenyl)-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-[7-(2-amino-6-fluorophenyl)-6-chloro-1-(4-formyl-2-methyl-6-propan-2-ylphenyl)-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146253251 |
| Molecular Formula | C34H40ClFN6O5S |
| Molecular Weight | 699.25 g/mol |
| Exact Mass | 698.25 |
| IUPAC Name | tert-butyl (2R,5S)-4-[7-(2-amino-6-fluorophenyl)-6-chloro-1-(4-formyl-2-methyl-6-propan-2-ylphenyl)-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | Cc1cc(C=O)cc(C(C)C)c1N1c2nc(-c3c(N)cccc3F)c(Cl)cc2C(N2C[C@@H](C)N(C(=O)OC(C)(C)C)C[C@@H]2C)=NS1(=O)=O |
| InChI | InChI=1S/C34H40ClFN6O5S/c1-18(2)23-13-22(17-43)12-19(3)30(23)42-31-24(14-25(35)29(38-31)28-26(36)10-9-11-27(28)37)32(39-48(42,45)46)40-15-21(5)41(16-20(40)4)33(44)47-34(6,7)8/h9-14,17-18,20-21H,15-16,37H2,1-8H3/t20-,21+/m0/s1 |
| InChIKey | MHTZVKWRADGGFF-LEWJYISDSA-N |
| XLogP | 6.84 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.25 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|