C27H28ClFN6O4S2 — CID 146253071
1-[4-[6-chloro-7-(2-fluoro-6-hydroxyphenyl)-2,2-dioxo-1-(4-propan-2-yl-1,3-thiazol-5-yl)pyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 146253071) has the molecular formula C27H28ClFN6O4S2 and a molecular weight of 619.14 g/mol. Its IUPAC name is 1-[4-[6-chloro-7-(2-fluoro-6-hydroxyphenyl)-2,2-dioxo-1-(4-propan-2-yl-1,3-thiazol-5-yl)pyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[6-chloro-7-(2-fluoro-6-hydroxyphenyl)-2,2-dioxo-1-(4-propan-2-yl-1,3-thiazol-5-yl)pyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146253071 |
| Molecular Formula | C27H28ClFN6O4S2 |
| Molecular Weight | 619.14 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | 1-[4-[6-chloro-7-(2-fluoro-6-hydroxyphenyl)-2,2-dioxo-1-(4-propan-2-yl-1,3-thiazol-5-yl)pyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C)N(C2=NS(=O)(=O)N(c3scnc3C(C)C)c3nc(-c4c(O)cccc4F)c(Cl)cc32)CC1C |
| InChI | InChI=1S/C27H28ClFN6O4S2/c1-6-21(37)33-11-16(5)34(12-15(33)4)26-17-10-18(28)24(22-19(29)8-7-9-20(22)36)31-25(17)35(41(38,39)32-26)27-23(14(2)3)30-13-40-27/h6-10,13-16,36H,1,11-12H2,2-5H3 |
| InChIKey | SRPRDVUZFPKDQY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.14 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|