C30H33ClFN7O3S — CID 146236226
1-[(2R,5S)-4-[1-(6-amino-4-methyl-2-propan-2-yl-3-pyridinyl)-6-chloro-7-(2-fluorophenyl)-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 146236226) has the molecular formula C30H33ClFN7O3S and a molecular weight of 626.16 g/mol. Its IUPAC name is 1-[(2R,5S)-4-[1-(6-amino-4-methyl-2-propan-2-yl-3-pyridinyl)-6-chloro-7-(2-fluorophenyl)-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,5S)-4-[1-(6-amino-4-methyl-2-propan-2-yl-3-pyridinyl)-6-chloro-7-(2-fluorophenyl)-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146236226 |
| Molecular Formula | C30H33ClFN7O3S |
| Molecular Weight | 626.16 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | 1-[(2R,5S)-4-[1-(6-amino-4-methyl-2-propan-2-yl-3-pyridinyl)-6-chloro-7-(2-fluorophenyl)-2,2-dioxopyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2=NS(=O)(=O)N(c3c(C)cc(N)nc3C(C)C)c3nc(-c4ccccc4F)c(Cl)cc32)C[C@H]1C |
| InChI | InChI=1S/C30H33ClFN7O3S/c1-7-25(40)37-14-19(6)38(15-18(37)5)30-21-13-22(31)27(20-10-8-9-11-23(20)32)35-29(21)39(43(41,42)36-30)28-17(4)12-24(33)34-26(28)16(2)3/h7-13,16,18-19H,1,14-15H2,2-6H3,(H2,33,34)/t18-,19+/m1/s1 |
| InChIKey | NCCNJJOAIRVHQZ-MOPGFXCFSA-N |
| XLogP | 5.20 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.16 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|