C28H32ClFN8O3S — CID 146236276
1-[(2R,5S)-4-[1-(4-amino-6-propan-2-ylpyrimidin-5-yl)-6-chloro-7-(2-fluorophenyl)-2,2-dihydroxypyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 146236276) has the molecular formula C28H32ClFN8O3S and a molecular weight of 615.14 g/mol. Its IUPAC name is 1-[(2R,5S)-4-[1-(4-amino-6-propan-2-ylpyrimidin-5-yl)-6-chloro-7-(2-fluorophenyl)-2,2-dihydroxypyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,5S)-4-[1-(4-amino-6-propan-2-ylpyrimidin-5-yl)-6-chloro-7-(2-fluorophenyl)-2,2-dihydroxypyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146236276 |
| Molecular Formula | C28H32ClFN8O3S |
| Molecular Weight | 615.14 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | 1-[(2R,5S)-4-[1-(4-amino-6-propan-2-ylpyrimidin-5-yl)-6-chloro-7-(2-fluorophenyl)-2,2-dihydroxypyrido[2,3-c][1,2,6]thiadiazin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2=NS(O)(O)N(c3c(N)ncnc3C(C)C)c3nc(-c4ccccc4F)c(Cl)cc32)C[C@H]1C |
| InChI | InChI=1S/C28H32ClFN8O3S/c1-6-22(39)36-12-17(5)37(13-16(36)4)28-19-11-20(29)24(18-9-7-8-10-21(18)30)34-27(19)38(42(40,41)35-28)25-23(15(2)3)32-14-33-26(25)31/h6-11,14-17,40-41H,1,12-13H2,2-5H3,(H2,31,32,33)/t16-,17+/m1/s1 |
| InChIKey | MMBNBMSIRQJKSA-SJORKVTESA-N |
| XLogP | 5.62 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.14 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|