C25H19NO8 — CID 134270722
dibenzyl 3-(methoxymethyl)-5,7-dioxofuro[3,4-b]pyridine-2,4-dicarboxylate (PubChem CID 134270722) has the molecular formula C25H19NO8 and a molecular weight of 461.43 g/mol. Its IUPAC name is dibenzyl 3-(methoxymethyl)-5,7-dioxofuro[3,4-b]pyridine-2,4-dicarboxylate.
| Compound Name | dibenzyl 3-(methoxymethyl)-5,7-dioxofuro[3,4-b]pyridine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134270722 |
| Molecular Formula | C25H19NO8 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | dibenzyl 3-(methoxymethyl)-5,7-dioxofuro[3,4-b]pyridine-2,4-dicarboxylate |
| SMILES | COCc1c(C(=O)OCc2ccccc2)nc2c(c1C(=O)OCc1ccccc1)C(=O)OC2=O |
| InChI | InChI=1S/C25H19NO8/c1-31-14-17-18(22(27)32-12-15-8-4-2-5-9-15)19-21(25(30)34-23(19)28)26-20(17)24(29)33-13-16-10-6-3-7-11-16/h2-11H,12-14H2,1H3 |
| InChIKey | WPQGALUUVBBSTR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|