C23H25N5O2 — CID 66716682
ethyl 6-(6-cyano-3-pyridinyl)-4-[3-(dimethylamino)propylamino]quinoline-3-carboxylate (PubChem CID 66716682) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is ethyl 6-(6-cyano-3-pyridinyl)-4-[3-(dimethylamino)propylamino]quinoline-3-carboxylate.
| Compound Name | ethyl 6-(6-cyano-3-pyridinyl)-4-[3-(dimethylamino)propylamino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 66716682 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | ethyl 6-(6-cyano-3-pyridinyl)-4-[3-(dimethylamino)propylamino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(-c3ccc(C#N)nc3)cc2c1NCCCN(C)C |
| InChI | InChI=1S/C23H25N5O2/c1-4-30-23(29)20-15-27-21-9-7-16(17-6-8-18(13-24)26-14-17)12-19(21)22(20)25-10-5-11-28(2)3/h6-9,12,14-15H,4-5,10-11H2,1-3H3,(H,25,27) |
| InChIKey | GODVKMUUYXLIGK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|