C23H28N4O2 — CID 66716137
4-[3-(dimethylamino)propylamino]-6-(4-hydroxyphenyl)-N,N-dimethylquinoline-3-carboxamide (PubChem CID 66716137) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylamino]-6-(4-hydroxyphenyl)-N,N-dimethylquinoline-3-carboxamide.
| Compound Name | 4-[3-(dimethylamino)propylamino]-6-(4-hydroxyphenyl)-N,N-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66716137 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-[3-(dimethylamino)propylamino]-6-(4-hydroxyphenyl)-N,N-dimethylquinoline-3-carboxamide |
| SMILES | CN(C)CCCNc1c(C(=O)N(C)C)cnc2ccc(-c3ccc(O)cc3)cc12 |
| InChI | InChI=1S/C23H28N4O2/c1-26(2)13-5-12-24-22-19-14-17(16-6-9-18(28)10-7-16)8-11-21(19)25-15-20(22)23(29)27(3)4/h6-11,14-15,28H,5,12-13H2,1-4H3,(H,24,25) |
| InChIKey | HEQHOPKSACAAII-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|