C12H12N2O2 — CID 175724068
6-hydroxy-N,N-dimethylquinoline-4-carboxamide (PubChem CID 175724068) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-hydroxy-N,N-dimethylquinoline-4-carboxamide.
| Compound Name | 6-hydroxy-N,N-dimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 175724068 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-hydroxy-N,N-dimethylquinoline-4-carboxamide |
| SMILES | CN(C)C(=O)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C12H12N2O2/c1-14(2)12(16)9-5-6-13-11-4-3-8(15)7-10(9)11/h3-7,15H,1-2H3 |
| InChIKey | CMVCPVBCQFWTRD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |