C26H26N2O2 — CID 69445356
ethyl 5-cyano-4-(4-methylphenyl)-6-(2-methylpropyl)-2-phenylpyridine-3-carboxylate (PubChem CID 69445356) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethyl 5-cyano-4-(4-methylphenyl)-6-(2-methylpropyl)-2-phenylpyridine-3-carboxylate.
| Compound Name | ethyl 5-cyano-4-(4-methylphenyl)-6-(2-methylpropyl)-2-phenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 69445356 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | ethyl 5-cyano-4-(4-methylphenyl)-6-(2-methylpropyl)-2-phenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nc(CC(C)C)c(C#N)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C26H26N2O2/c1-5-30-26(29)24-23(19-13-11-18(4)12-14-19)21(16-27)22(15-17(2)3)28-25(24)20-9-7-6-8-10-20/h6-14,17H,5,15H2,1-4H3 |
| InChIKey | ISXRUBBWQKIAHM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |