C25H26N2O3 — CID 68830320
2-[3-cyano-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]oxyethyl acetate (PubChem CID 68830320) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[3-cyano-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]oxyethyl acetate.
| Compound Name | 2-[3-cyano-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]oxyethyl acetate |
|---|---|
| PubChem CID | 68830320 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[3-cyano-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]oxyethyl acetate |
| SMILES | CC(=O)OCCOc1ccc2nc(CC(C)C)c(C#N)c(-c3ccc(C)cc3)c2c1 |
| InChI | InChI=1S/C25H26N2O3/c1-16(2)13-24-22(15-26)25(19-7-5-17(3)6-8-19)21-14-20(9-10-23(21)27-24)30-12-11-29-18(4)28/h5-10,14,16H,11-13H2,1-4H3 |
| InChIKey | WZFYHJQWYRXKAT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|