C30H39N3O4 — CID 91370597
[6-(4-amino-4-oxobutoxy)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-3-yl]methyl N-tert-butylcarbamate (PubChem CID 91370597) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is [6-(4-amino-4-oxobutoxy)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-3-yl]methyl N-tert-butylcarbamate.
| Compound Name | [6-(4-amino-4-oxobutoxy)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-3-yl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91370597 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | [6-(4-amino-4-oxobutoxy)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-3-yl]methyl N-tert-butylcarbamate |
| SMILES | Cc1ccc(-c2c(COC(=O)NC(C)(C)C)c(CC(C)C)nc3ccc(OCCCC(N)=O)cc23)cc1 |
| InChI | InChI=1S/C30H39N3O4/c1-19(2)16-26-24(18-37-29(35)33-30(4,5)6)28(21-11-9-20(3)10-12-21)23-17-22(13-14-25(23)32-26)36-15-7-8-27(31)34/h9-14,17,19H,7-8,15-16,18H2,1-6H3,(H2,31,34)(H,33,35) |
| InChIKey | PVDQNJUHAXXBTH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|