C24H25N3O3 — CID 68834233
[6-(cyanomethoxy)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-3-yl]methylcarbamic acid (PubChem CID 68834233) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is [6-(cyanomethoxy)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-3-yl]methylcarbamic acid.
| Compound Name | [6-(cyanomethoxy)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-3-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 68834233 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [6-(cyanomethoxy)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-3-yl]methylcarbamic acid |
| SMILES | Cc1ccc(-c2c(CNC(=O)O)c(CC(C)C)nc3ccc(OCC#N)cc23)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-15(2)12-22-20(14-26-24(28)29)23(17-6-4-16(3)5-7-17)19-13-18(30-11-10-25)8-9-21(19)27-22/h4-9,13,15,26H,11-12,14H2,1-3H3,(H,28,29) |
| InChIKey | FPSAXSMPPLQGKD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |