C32H36N2O6S — CID 87590892
(4-methylphenyl)sulfonyl 2-[2-[3-(aminomethyl)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]oxyethoxy]acetate (PubChem CID 87590892) has the molecular formula C32H36N2O6S and a molecular weight of 576.72 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl 2-[2-[3-(aminomethyl)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]oxyethoxy]acetate.
| Compound Name | (4-methylphenyl)sulfonyl 2-[2-[3-(aminomethyl)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]oxyethoxy]acetate |
|---|---|
| PubChem CID | 87590892 |
| Molecular Formula | C32H36N2O6S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (4-methylphenyl)sulfonyl 2-[2-[3-(aminomethyl)-4-(4-methylphenyl)-2-(2-methylpropyl)quinolin-6-yl]oxyethoxy]acetate |
| SMILES | Cc1ccc(-c2c(CN)c(CC(C)C)nc3ccc(OCCOCC(=O)OS(=O)(=O)c4ccc(C)cc4)cc23)cc1 |
| InChI | InChI=1S/C32H36N2O6S/c1-21(2)17-30-28(19-33)32(24-9-5-22(3)6-10-24)27-18-25(11-14-29(27)34-30)39-16-15-38-20-31(35)40-41(36,37)26-12-7-23(4)8-13-26/h5-14,18,21H,15-17,19-20,33H2,1-4H3 |
| InChIKey | YNULLINSWNRPSU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|