C29H21NO4 — CID 102460014
ethyl 3-benzoyl-4-formyl-2-phenylpyrrolo[1,2-a]quinoline-1-carboxylate (PubChem CID 102460014) has the molecular formula C29H21NO4 and a molecular weight of 447.49 g/mol. Its IUPAC name is ethyl 3-benzoyl-4-formyl-2-phenylpyrrolo[1,2-a]quinoline-1-carboxylate.
| Compound Name | ethyl 3-benzoyl-4-formyl-2-phenylpyrrolo[1,2-a]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 102460014 |
| Molecular Formula | C29H21NO4 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | ethyl 3-benzoyl-4-formyl-2-phenylpyrrolo[1,2-a]quinoline-1-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c(C(=O)c2ccccc2)c2c(C=O)cc3ccccc3n12 |
| InChI | InChI=1S/C29H21NO4/c1-2-34-29(33)27-24(19-11-5-3-6-12-19)25(28(32)20-13-7-4-8-14-20)26-22(18-31)17-21-15-9-10-16-23(21)30(26)27/h3-18H,2H2,1H3 |
| InChIKey | QIXJYJBUBLQGSE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|