About 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate
2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate (PubChem CID 66914809) has the molecular formula C20H24ClNO4
and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate |
| PubChem CID | 66914809 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c(C(=O)OCCCCl)n(CC)c1C |
| InChI | InChI=1S/C20H24ClNO4/c1-4-22-14(3)16(19(23)25-5-2)17(15-10-7-6-8-11-15)18(22)20(24)26-13-9-12-21/h6-8,10-11H,4-5,9,12-13H2,1-3H3 |
| InChIKey | HZMPHMQYEQZMCN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate?
The IUPAC name of 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate (CID 66914809) is 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate.
What is the SMILES notation for 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate?
The canonical SMILES for 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate is CCOC(=O)c1c(-c2ccccc2)c(C(=O)OCCCCl)n(CC)c1C.
What is the InChIKey of 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate?
The InChIKey is HZMPHMQYEQZMCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24ClNO4/c1-4-22-14(3)16(19(23)25-5-2)17(15-10-7-6-8-11-15)18(22)20(24)26-13-9-12-21/h6-8,10-11H,4-5,9,12-13H2,1-3H3.
What are the key properties of 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate?
2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate has a molecular weight of 377.87 g/mol, XLogP of 4.45, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(3-chloropropyl) 4-O-ethyl 1-ethyl-5-methyl-3-phenylpyrrole-2,4-dicarboxylate is sourced from PubChem (CID 66914809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).