C21H20N2O2 — CID 12525631
ethyl 1,5-diphenyl-3-[(E)-prop-1-enyl]pyrazole-4-carboxylate (PubChem CID 12525631) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl 1,5-diphenyl-3-[(E)-prop-1-enyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1,5-diphenyl-3-[(E)-prop-1-enyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 12525631 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | ethyl 1,5-diphenyl-3-[(E)-prop-1-enyl]pyrazole-4-carboxylate |
| SMILES | C/C=C/c1nn(-c2ccccc2)c(-c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C21H20N2O2/c1-3-11-18-19(21(24)25-4-2)20(16-12-7-5-8-13-16)23(22-18)17-14-9-6-10-15-17/h3,5-15H,4H2,1-2H3/b11-3+ |
| InChIKey | VFNDXQYXUDQHEN-QDEBKDIKSA-N |
| XLogP | 4.75 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |