ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate

C22H24N2O2 — CID 102030318

IUPACethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate
SMILESCCOC(=O)c1c(-c2ccccc2)nn(-c2ccccc2)c1C(C)CC
InChIInChI=1S/C22H24N2O2/c1-4-16(3)21-19(22(25)26-5-2)20(17-12-8-6-9-13-17)23-24(21)18-14-10-7-11-15-18/h6-16H,4-5H2,1-3H3
InChIKeyVEJZZELUVYCLNS-UHFFFAOYSA-N
MW348.45 g/mol
LogP5.23
Rot. Bonds6

About ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate

ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate (PubChem CID 102030318) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate.

Molecular Properties

Compound Nameethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate
PubChem CID102030318
Molecular FormulaC22H24N2O2
Molecular Weight348.45 g/mol
Exact Mass348.18
IUPAC Nameethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate
SMILESCCOC(=O)c1c(-c2ccccc2)nn(-c2ccccc2)c1C(C)CC
InChIInChI=1S/C22H24N2O2/c1-4-16(3)21-19(22(25)26-5-2)20(17-12-8-6-9-13-17)23-24(21)18-14-10-7-11-15-18/h6-16H,4-5H2,1-3H3
InChIKeyVEJZZELUVYCLNS-UHFFFAOYSA-N
XLogP5.23
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500348.45
LogP ≤ 55.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate?
The IUPAC name of ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate (CID 102030318) is ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate is CCOC(=O)c1c(-c2ccccc2)nn(-c2ccccc2)c1C(C)CC.
What is the InChIKey of ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate?
The InChIKey is VEJZZELUVYCLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2/c1-4-16(3)21-19(22(25)26-5-2)20(17-12-8-6-9-13-17)23-24(21)18-14-10-7-11-15-18/h6-16H,4-5H2,1-3H3.
What are the key properties of ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate?
ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate has a molecular weight of 348.45 g/mol, XLogP of 5.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-butan-2-yl-1,3-diphenylpyrazole-4-carboxylate is sourced from PubChem (CID 102030318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).