C27H22F2N4O3S — CID 122186186
ethyl 5-[[6-(difluoromethoxy)-2-sulfanylidene-3H-benzimidazol-1-yl]methyl]-1,3-diphenylpyrazole-4-carboxylate (PubChem CID 122186186) has the molecular formula C27H22F2N4O3S and a molecular weight of 520.56 g/mol. Its IUPAC name is ethyl 5-[[6-(difluoromethoxy)-2-sulfanylidene-3H-benzimidazol-1-yl]methyl]-1,3-diphenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[6-(difluoromethoxy)-2-sulfanylidene-3H-benzimidazol-1-yl]methyl]-1,3-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 122186186 |
| Molecular Formula | C27H22F2N4O3S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | ethyl 5-[[6-(difluoromethoxy)-2-sulfanylidene-3H-benzimidazol-1-yl]methyl]-1,3-diphenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nn(-c2ccccc2)c1Cn1c(=S)[nH]c2ccc(OC(F)F)cc21 |
| InChI | InChI=1S/C27H22F2N4O3S/c1-2-35-25(34)23-22(16-32-21-15-19(36-26(28)29)13-14-20(21)30-27(32)37)33(18-11-7-4-8-12-18)31-24(23)17-9-5-3-6-10-17/h3-15,26H,2,16H2,1H3,(H,30,37) |
| InChIKey | PXRGVDMERQJUPC-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|