C28H23N3O5 — CID 169409756
ethyl 2-methyl-1-naphthalen-2-yl-5-phenyl-4-(2,4,6-trioxo-1,3-diazinan-5-yl)pyrrole-3-carboxylate (PubChem CID 169409756) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is ethyl 2-methyl-1-naphthalen-2-yl-5-phenyl-4-(2,4,6-trioxo-1,3-diazinan-5-yl)pyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-1-naphthalen-2-yl-5-phenyl-4-(2,4,6-trioxo-1,3-diazinan-5-yl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 169409756 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | ethyl 2-methyl-1-naphthalen-2-yl-5-phenyl-4-(2,4,6-trioxo-1,3-diazinan-5-yl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2C(=O)NC(=O)NC2=O)c(-c2ccccc2)n(-c2ccc3ccccc3c2)c1C |
| InChI | InChI=1S/C28H23N3O5/c1-3-36-27(34)21-16(2)31(20-14-13-17-9-7-8-12-19(17)15-20)24(18-10-5-4-6-11-18)22(21)23-25(32)29-28(35)30-26(23)33/h4-15,23H,3H2,1-2H3,(H2,29,30,32,33,35) |
| InChIKey | OOKVIOQFNIHHLG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|