C13H14N2O4 — CID 82302598
5-(2,4-dimethoxyphenyl)-1-methylpyrazole-4-carboxylic acid (PubChem CID 82302598) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-(2,4-dimethoxyphenyl)-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82302598 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-1-methylpyrazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2c(C(=O)O)cnn2C)c(OC)c1 |
| InChI | InChI=1S/C13H14N2O4/c1-15-12(10(7-14-15)13(16)17)9-5-4-8(18-2)6-11(9)19-3/h4-7H,1-3H3,(H,16,17) |
| InChIKey | GGMYTCVKMJXDCT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |