3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid

C15H18N2O4 — CID 61266679

IUPAC3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid
SMILESCCCn1cc(C(=O)O)c(-c2ccc(OC)cc2OC)n1
InChIInChI=1S/C15H18N2O4/c1-4-7-17-9-12(15(18)19)14(16-17)11-6-5-10(20-2)8-13(11)21-3/h5-6,8-9H,4,7H2,1-3H3,(H,18,19)
InChIKeyMMLHBRBLTXFLAK-UHFFFAOYSA-N
MW290.32 g/mol
LogP2.68
Rot. Bonds6

About 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid

3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid (PubChem CID 61266679) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid.

Molecular Properties

Compound Name3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid
PubChem CID61266679
Molecular FormulaC15H18N2O4
Molecular Weight290.32 g/mol
Exact Mass290.13
IUPAC Name3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid
SMILESCCCn1cc(C(=O)O)c(-c2ccc(OC)cc2OC)n1
InChIInChI=1S/C15H18N2O4/c1-4-7-17-9-12(15(18)19)14(16-17)11-6-5-10(20-2)8-13(11)21-3/h5-6,8-9H,4,7H2,1-3H3,(H,18,19)
InChIKeyMMLHBRBLTXFLAK-UHFFFAOYSA-N
XLogP2.68
TPSA73.58 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.32
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid (CID 61266679) is 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid is CCCn1cc(C(=O)O)c(-c2ccc(OC)cc2OC)n1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid?
The InChIKey is MMLHBRBLTXFLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4/c1-4-7-17-9-12(15(18)19)14(16-17)11-6-5-10(20-2)8-13(11)21-3/h5-6,8-9H,4,7H2,1-3H3,(H,18,19).
What are the key properties of 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid?
3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid has a molecular weight of 290.32 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-1-propylpyrazole-4-carboxylic acid is sourced from PubChem (CID 61266679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).