C12H13N3O4 — CID 82365358
5-amino-1-(2,4-dimethoxyphenyl)pyrazole-4-carboxylic acid (PubChem CID 82365358) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 5-amino-1-(2,4-dimethoxyphenyl)pyrazole-4-carboxylic acid.
| Compound Name | 5-amino-1-(2,4-dimethoxyphenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82365358 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-amino-1-(2,4-dimethoxyphenyl)pyrazole-4-carboxylic acid |
| SMILES | COc1ccc(-n2ncc(C(=O)O)c2N)c(OC)c1 |
| InChI | InChI=1S/C12H13N3O4/c1-18-7-3-4-9(10(5-7)19-2)15-11(13)8(6-14-15)12(16)17/h3-6H,13H2,1-2H3,(H,16,17) |
| InChIKey | HMAQSEHSRFJUJT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |