C13H15N3O2S — CID 82527837
1-(2,5-dimethoxyphenyl)-5-methylpyrazole-4-carbothioamide (PubChem CID 82527837) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-methylpyrazole-4-carbothioamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-methylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 82527837 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-methylpyrazole-4-carbothioamide |
| SMILES | COc1ccc(OC)c(-n2ncc(C(N)=S)c2C)c1 |
| InChI | InChI=1S/C13H15N3O2S/c1-8-10(13(14)19)7-15-16(8)11-6-9(17-2)4-5-12(11)18-3/h4-7H,1-3H3,(H2,14,19) |
| InChIKey | VGPCYIKCCGXLDN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|