C13H12N4O3S — CID 136816864
1-(2,5-dimethoxyphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136816864) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136816864 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | COc1ccc(OC)c(-n2ncc3c(=O)[nH]c(=S)[nH]c32)c1 |
| InChI | InChI=1S/C13H12N4O3S/c1-19-7-3-4-10(20-2)9(5-7)17-11-8(6-14-17)12(18)16-13(21)15-11/h3-6H,1-2H3,(H2,15,16,18,21) |
| InChIKey | OUEJBZCYQJVGNW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|