C28H32FNO3 — CID 110063182
2-fluoro-6-[(5-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)methyl]phenol (PubChem CID 110063182) has the molecular formula C28H32FNO3 and a molecular weight of 449.57 g/mol. Its IUPAC name is 2-fluoro-6-[(5-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)methyl]phenol.
| Compound Name | 2-fluoro-6-[(5-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)methyl]phenol |
|---|---|
| PubChem CID | 110063182 |
| Molecular Formula | C28H32FNO3 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-fluoro-6-[(5-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)methyl]phenol |
| SMILES | CC(C)c1ccc2c(c1)Cc1cccc(c1)CN(Cc1cccc(F)c1O)CCOCCO2 |
| InChI | InChI=1S/C28H32FNO3/c1-20(2)23-9-10-27-25(17-23)16-21-5-3-6-22(15-21)18-30(11-12-32-13-14-33-27)19-24-7-4-8-26(29)28(24)31/h3-10,15,17,20,31H,11-14,16,18-19H2,1-2H3 |
| InChIKey | GZOMBORHWFAZPI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|