C30H31FN2O3 — CID 133067329
5-(3,5-dimethyl-1,2-oxazol-4-yl)-15-[(2-fluorophenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene (PubChem CID 133067329) has the molecular formula C30H31FN2O3 and a molecular weight of 486.59 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-15-[(2-fluorophenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-15-[(2-fluorophenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene |
|---|---|
| PubChem CID | 133067329 |
| Molecular Formula | C30H31FN2O3 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-15-[(2-fluorophenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)Cc1cccc(c1)CN(Cc1ccccc1F)CCOCCO2 |
| InChI | InChI=1S/C30H31FN2O3/c1-21-30(22(2)36-32-21)25-10-11-29-27(18-25)17-23-6-5-7-24(16-23)19-33(12-13-34-14-15-35-29)20-26-8-3-4-9-28(26)31/h3-11,16,18H,12-15,17,19-20H2,1-2H3 |
| InChIKey | MGHRBNJFMXEEOL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |