C28H28N4O2 — CID 133067561
15-(pyridin-3-ylmethyl)-5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene (PubChem CID 133067561) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 15-(pyridin-3-ylmethyl)-5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene.
| Compound Name | 15-(pyridin-3-ylmethyl)-5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene |
|---|---|
| PubChem CID | 133067561 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 15-(pyridin-3-ylmethyl)-5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene |
| SMILES | c1cncc(CN2CCOCCOc3ccc(-c4cncnc4)cc3Cc3cccc(c3)C2)c1 |
| InChI | InChI=1S/C28H28N4O2/c1-3-22-13-23(4-1)19-32(20-24-5-2-8-29-16-24)9-10-33-11-12-34-28-7-6-25(15-26(28)14-22)27-17-30-21-31-18-27/h1-8,13,15-18,21H,9-12,14,19-20H2 |
| InChIKey | YXSRQQSFSZREDJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |