C27H32N4O3S — CID 110074780
(2R)-2-amino-4-methylsulfanyl-1-(5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)butan-1-one (PubChem CID 110074780) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanyl-1-(5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)butan-1-one.
| Compound Name | (2R)-2-amino-4-methylsulfanyl-1-(5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)butan-1-one |
|---|---|
| PubChem CID | 110074780 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanyl-1-(5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)butan-1-one |
| SMILES | CSCC[C@@H](N)C(=O)N1CCOCCOc2ccc(-c3cncnc3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C27H32N4O3S/c1-35-12-7-25(28)27(32)31-8-9-33-10-11-34-26-6-5-22(24-16-29-19-30-17-24)15-23(26)14-20-3-2-4-21(13-20)18-31/h2-6,13,15-17,19,25H,7-12,14,18,28H2,1H3/t25-/m1/s1 |
| InChIKey | TXWDDBKLYHLJSZ-RUZDIDTESA-N |
| XLogP | 3.55 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |