C32H34N4O3 — CID 110064390
(2S)-2-amino-4-phenyl-1-(5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)butan-1-one (PubChem CID 110064390) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is (2S)-2-amino-4-phenyl-1-(5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)butan-1-one.
| Compound Name | (2S)-2-amino-4-phenyl-1-(5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)butan-1-one |
|---|---|
| PubChem CID | 110064390 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | (2S)-2-amino-4-phenyl-1-(5-pyrimidin-5-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)butan-1-one |
| SMILES | N[C@@H](CCc1ccccc1)C(=O)N1CCOCCOc2ccc(-c3cncnc3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C32H34N4O3/c33-30(11-9-24-5-2-1-3-6-24)32(37)36-13-14-38-15-16-39-31-12-10-27(29-20-34-23-35-21-29)19-28(31)18-25-7-4-8-26(17-25)22-36/h1-8,10,12,17,19-21,23,30H,9,11,13-16,18,22,33H2/t30-/m0/s1 |
| InChIKey | MPUYQJQWLQTYOR-PMERELPUSA-N |
| XLogP | 4.43 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |