C26H34N2O5 — CID 110072790
2-[methyl-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid (PubChem CID 110072790) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[methyl-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[methyl-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 110072790 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[methyl-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid |
| SMILES | CC(C)CN1CCOCCOc2ccc(C(=O)N(C)CC(=O)O)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C26H34N2O5/c1-19(2)16-28-9-10-32-11-12-33-24-8-7-22(26(31)27(3)18-25(29)30)15-23(24)14-20-5-4-6-21(13-20)17-28/h4-8,13,15,19H,9-12,14,16-18H2,1-3H3,(H,29,30) |
| InChIKey | PTGNTIRDZJJJBL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |