C33H39ClN2O5 — CID 110072726
2-[(3-chlorophenyl)methyl-[15-(3-methylbutyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid (PubChem CID 110072726) has the molecular formula C33H39ClN2O5 and a molecular weight of 579.14 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-[15-(3-methylbutyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[(3-chlorophenyl)methyl-[15-(3-methylbutyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 110072726 |
| Molecular Formula | C33H39ClN2O5 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-[15-(3-methylbutyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid |
| SMILES | CC(C)CCN1CCOCCOc2ccc(C(=O)N(CC(=O)O)Cc3cccc(Cl)c3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C33H39ClN2O5/c1-24(2)11-12-35-13-14-40-15-16-41-31-10-9-28(20-29(31)18-25-5-3-6-26(17-25)21-35)33(39)36(23-32(37)38)22-27-7-4-8-30(34)19-27/h3-10,17,19-20,24H,11-16,18,21-23H2,1-2H3,(H,37,38) |
| InChIKey | AGWXDVLVKIEVKT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |