C34H40N2O4 — CID 110072737
2-[[15-(cyclopropylmethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]-[(4-methylphenyl)methyl]amino]acetic acid (PubChem CID 110072737) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is 2-[[15-(cyclopropylmethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]-[(4-methylphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[[15-(cyclopropylmethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]-[(4-methylphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 110072737 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 2-[[15-(cyclopropylmethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]-[(4-methylphenyl)methyl]amino]acetic acid |
| SMILES | Cc1ccc(CN(CC(=O)O)C(=O)c2ccc3c(c2)Cc2cccc(c2)CN(CC2CC2)CCCCCO3)cc1 |
| InChI | InChI=1S/C34H40N2O4/c1-25-8-10-27(11-9-25)23-36(24-33(37)38)34(39)30-14-15-32-31(20-30)19-28-6-5-7-29(18-28)22-35(21-26-12-13-26)16-3-2-4-17-40-32/h5-11,14-15,18,20,26H,2-4,12-13,16-17,19,21-24H2,1H3,(H,37,38) |
| InChIKey | RPMSEBUVIPYKAW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |