C30H35ClN2O3 — CID 110072456
N-[(4-chlorophenyl)methyl]-15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072456) has the molecular formula C30H35ClN2O3 and a molecular weight of 507.07 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072456 |
| Molecular Formula | C30H35ClN2O3 |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | CC(C)CN1CCOCCOc2ccc(C(=O)NCc3ccc(Cl)cc3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C30H35ClN2O3/c1-22(2)20-33-12-13-35-14-15-36-29-11-8-26(30(34)32-19-23-6-9-28(31)10-7-23)18-27(29)17-24-4-3-5-25(16-24)21-33/h3-11,16,18,22H,12-15,17,19-21H2,1-2H3,(H,32,34) |
| InChIKey | SBUYOOYVWNNIEX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |