C26H33N3O4 — CID 110070690
5-(4-propan-2-ylpiperazine-1-carbonyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one (PubChem CID 110070690) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 5-(4-propan-2-ylpiperazine-1-carbonyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one.
| Compound Name | 5-(4-propan-2-ylpiperazine-1-carbonyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one |
|---|---|
| PubChem CID | 110070690 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 5-(4-propan-2-ylpiperazine-1-carbonyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-16-one |
| SMILES | CC(C)N1CCN(C(=O)c2ccc3c(c2)Cc2cccc(c2)C(=O)NCCOCCO3)CC1 |
| InChI | InChI=1S/C26H33N3O4/c1-19(2)28-9-11-29(12-10-28)26(31)22-6-7-24-23(18-22)17-20-4-3-5-21(16-20)25(30)27-8-13-32-14-15-33-24/h3-7,16,18-19H,8-15,17H2,1-2H3,(H,27,30) |
| InChIKey | QEWCNBNPVKZOKQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |