C31H35N3O4 — CID 110067596
16-oxo-N-[(3-piperidin-1-ylphenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110067596) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is 16-oxo-N-[(3-piperidin-1-ylphenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | 16-oxo-N-[(3-piperidin-1-ylphenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110067596 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 16-oxo-N-[(3-piperidin-1-ylphenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | O=C1NCCOCCOc2ccc(C(=O)NCc3cccc(N4CCCCC4)c3)cc2Cc2cccc1c2 |
| InChI | InChI=1S/C31H35N3O4/c35-30-25-8-4-6-23(18-25)19-27-21-26(10-11-29(27)38-17-16-37-15-12-32-30)31(36)33-22-24-7-5-9-28(20-24)34-13-2-1-3-14-34/h4-11,18,20-21H,1-3,12-17,19,22H2,(H,32,35)(H,33,36) |
| InChIKey | LSWAXBAWASDBOU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |