C28H30N2O5 — CID 110067592
N-[[2-(methoxymethyl)phenyl]methyl]-16-oxo-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110067592) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-[[2-(methoxymethyl)phenyl]methyl]-16-oxo-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[[2-(methoxymethyl)phenyl]methyl]-16-oxo-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110067592 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-[[2-(methoxymethyl)phenyl]methyl]-16-oxo-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | COCc1ccccc1CNC(=O)c1ccc2c(c1)Cc1cccc(c1)C(=O)NCCOCCO2 |
| InChI | InChI=1S/C28H30N2O5/c1-33-19-24-7-3-2-6-23(24)18-30-28(32)22-9-10-26-25(17-22)16-20-5-4-8-21(15-20)27(31)29-11-12-34-13-14-35-26/h2-10,15,17H,11-14,16,18-19H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | BBNGBHBYXHDGHE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |