C23H31N3O3 — CID 155995066
N-[2-(dimethylamino)ethyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 155995066) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 155995066 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccc2c(c1)Cc1cccc(c1)CNCCOCCO2 |
| InChI | InChI=1S/C23H31N3O3/c1-26(2)10-8-25-23(27)20-6-7-22-21(16-20)15-18-4-3-5-19(14-18)17-24-9-11-28-12-13-29-22/h3-7,14,16,24H,8-13,15,17H2,1-2H3,(H,25,27) |
| InChIKey | JGWQXLPFTLFVER-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |