C26H35N3O4 — CID 155995073
N-(3-morpholin-4-ylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 155995073) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 155995073 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc2c(c1)Cc1cccc(c1)CNCCOCCO2 |
| InChI | InChI=1S/C26H35N3O4/c30-26(28-7-2-9-29-10-13-32-14-11-29)23-5-6-25-24(19-23)18-21-3-1-4-22(17-21)20-27-8-12-31-15-16-33-25/h1,3-6,17,19,27H,2,7-16,18,20H2,(H,28,30) |
| InChIKey | PXAZYPFMSCMFPN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|