C13H19F3N2O5S — CID 118174501
tert-butyl (8aS)-7-(trifluoromethylsulfonyloxy)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate (PubChem CID 118174501) has the molecular formula C13H19F3N2O5S and a molecular weight of 372.37 g/mol. Its IUPAC name is tert-butyl (8aS)-7-(trifluoromethylsulfonyloxy)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl (8aS)-7-(trifluoromethylsulfonyloxy)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 118174501 |
| Molecular Formula | C13H19F3N2O5S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | tert-butyl (8aS)-7-(trifluoromethylsulfonyloxy)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C=C(OS(=O)(=O)C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C13H19F3N2O5S/c1-12(2,3)22-11(19)18-5-4-17-8-10(6-9(17)7-18)23-24(20,21)13(14,15)16/h8-9H,4-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | ZGHAOWAZALIQLZ-VIFPVBQESA-N |
| XLogP | 2.02 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|