C11H19F3N2O4S — CID 154026528
tert-butyl 4-methylsulfonyl-3-(trifluoromethyl)piperazine-1-carboxylate (PubChem CID 154026528) has the molecular formula C11H19F3N2O4S and a molecular weight of 332.34 g/mol. Its IUPAC name is tert-butyl 4-methylsulfonyl-3-(trifluoromethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-methylsulfonyl-3-(trifluoromethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154026528 |
| Molecular Formula | C11H19F3N2O4S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | tert-butyl 4-methylsulfonyl-3-(trifluoromethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(C)(=O)=O)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O4S/c1-10(2,3)20-9(17)15-5-6-16(21(4,18)19)8(7-15)11(12,13)14/h8H,5-7H2,1-4H3 |
| InChIKey | AZWLPUUZCFDWDJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |