C10H20N2O3S — CID 125499804
tert-butyl (3S)-3-(methylsulfonimidoyl)pyrrolidine-1-carboxylate (PubChem CID 125499804) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-(methylsulfonimidoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(methylsulfonimidoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 125499804 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | tert-butyl (3S)-3-(methylsulfonimidoyl)pyrrolidine-1-carboxylate |
| SMILES | [H]N=[S@](C)(=O)[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H20N2O3S/c1-10(2,3)15-9(13)12-6-5-8(7-12)16(4,11)14/h8,11H,5-7H2,1-4H3/t8-,16+/m0/s1 |
| InChIKey | JYOPAUPKXFQZPE-ZKANADHPSA-N |
| XLogP | 1.67 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |