C16H23N3O6S — CID 170033573
tert-butyl 3-[[(4-hydroxybenzoyl)amino]sulfamoyl]pyrrolidine-1-carboxylate (PubChem CID 170033573) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is tert-butyl 3-[[(4-hydroxybenzoyl)amino]sulfamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(4-hydroxybenzoyl)amino]sulfamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170033573 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | tert-butyl 3-[[(4-hydroxybenzoyl)amino]sulfamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)NNC(=O)c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C16H23N3O6S/c1-16(2,3)25-15(22)19-9-8-13(10-19)26(23,24)18-17-14(21)11-4-6-12(20)7-5-11/h4-7,13,18,20H,8-10H2,1-3H3,(H,17,21) |
| InChIKey | PGBIFHFSKMOFAL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|