C25H36N2O4SSi — CID 154660373
tert-butyl 3-[[tert-butyl(diphenyl)silyl]sulfamoyl]pyrrolidine-1-carboxylate (PubChem CID 154660373) has the molecular formula C25H36N2O4SSi and a molecular weight of 488.73 g/mol. Its IUPAC name is tert-butyl 3-[[tert-butyl(diphenyl)silyl]sulfamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[tert-butyl(diphenyl)silyl]sulfamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154660373 |
| Molecular Formula | C25H36N2O4SSi |
| Molecular Weight | 488.73 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | tert-butyl 3-[[tert-butyl(diphenyl)silyl]sulfamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)N[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H36N2O4SSi/c1-24(2,3)31-23(28)27-18-17-20(19-27)32(29,30)26-33(25(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,26H,17-19H2,1-6H3 |
| InChIKey | IGESESOCWWHAKJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|