C14H26N2O6S — CID 166071281
tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]pyrrolidine-1-carboxylate (PubChem CID 166071281) has the molecular formula C14H26N2O6S and a molecular weight of 350.44 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166071281 |
| Molecular Formula | C14H26N2O6S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H26N2O6S/c1-13(2,3)21-11(17)15-23(19,20)10-7-8-16(9-10)12(18)22-14(4,5)6/h10H,7-9H2,1-6H3,(H,15,17) |
| InChIKey | JHRJNTGIVZLPMQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |