C8H17N3O4S — CID 153328230
tert-butyl 3-(hydrazinesulfonyl)azetidine-1-carboxylate (PubChem CID 153328230) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is tert-butyl 3-(hydrazinesulfonyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(hydrazinesulfonyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 153328230 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | tert-butyl 3-(hydrazinesulfonyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(S(=O)(=O)NN)C1 |
| InChI | InChI=1S/C8H17N3O4S/c1-8(2,3)15-7(12)11-4-6(5-11)16(13,14)10-9/h6,10H,4-5,9H2,1-3H3 |
| InChIKey | CETBFPKYODODND-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|